![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](copr-git-al91-nov22.png)
![[IMG]](copr-stats-jul22.png)
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| xen-4.21~rc1-2.el9/ | 2025-10-28 22:04 | - | |
| alma+epel-9-x86_64/ | 2025-10-27 10:12 | - | |
| xen-4.21~rc1-1.el9/ | 2025-10-08 18:49 | - | |
| virtextra/ | 2025-09-06 14:57 | - | |
| xen-4.20.1-2.el9/ | 2025-07-24 14:08 | - | |
| xen-4.20.1-1.el9/ | 2025-07-11 16:34 | - | |
| xen-4.20.0-8.el9/ | 2025-07-08 15:14 | - | |
| xen-4.20.0-4.el9/ | 2025-05-14 10:28 | - | |
| icinga2-2025/ | 2025-04-07 16:16 | - | |
| qemu-9.2.0-1.el9/ | 2025-03-18 12:42 | - | |
| flask/ | 2025-03-18 12:41 | - | |
| icinga2/ | 2025-03-18 12:40 | - | |
| xen-4.19.1-3.el9/ | 2025-02-02 13:34 | - | |
| xen-4.19.1-4.el9/ | 2025-02-02 13:34 | - | |
| xen-4.19.1-2.el9/ | 2025-01-15 13:09 | - | |
| jan25/ | 2024-12-08 13:10 | - | |
| qemu-8.1.4-1.el9/ | 2024-01-19 16:02 | - | |
| rust-mysql_common-0.31.0-1.el9/ | 2024-01-13 17:06 | - | |
| oraclelinux+epel-9-x86_64/ | 2024-01-09 09:57 | - | |
| rust-proc-macro2-1.0.53-1.fc38/ | 2024-01-09 09:40 | - | |
| ol9-park/ | 2024-01-07 22:16 | - | |
| xen-4.18.0-1.el9/ | 2023-11-17 14:25 | - | |
| qemu-8.1.0-1.fc39/ | 2023-09-24 16:44 | - | |
| rust-num-traits-0.2.14-5.fc36/ | 2023-09-04 15:07 | - | |
| rust-proc-macro2-1.0.36-2.fc36/ | 2023-08-04 16:51 | - | |
| rust-serde_json-1.0.79-1.fc36/ | 2023-08-04 14:11 | - | |
| rust-serde_derive-1.0.136-1.fc36/ | 2023-08-04 14:06 | - | |
| rust-serde-1.0.136-1.fc36/ | 2023-08-04 14:05 | - | |
| m-synapse-181/ | 2023-07-21 09:52 | - | |
| nov29/ | 2023-06-04 17:52 | - | |
| pantheonDT/ | 2023-05-14 10:59 | - | |
| rust-packaging-24-1.fc36/ | 2023-04-22 17:35 | - | |
| jan25-ut/ | 2023-04-14 20:22 | - | |
| nov26/ | 2023-04-05 13:44 | - | |
| rpkg-1.65-3.el9/ | 2023-03-16 11:43 | - | |
| xen-4.16.2-2.el9/ | 2022-09-27 13:02 | - | |
| epel.repo | 2025-09-22 19:21 | 1.6K | |
| RPM-GPG-KEY-EPEL-9 | 2025-04-22 10:18 | 1.6K | |
| file-tree-copr.html | 2025-02-15 20:12 | 2.6K | |
| robots.txt | 2025-01-04 09:38 | 888 | |
| fixnm.tar.xz | 2024-05-22 17:21 | 744 | |
| xen-4.18.0-3.el9.src.rpm | 2023-12-29 10:47 | 62M | |
| virt-copr9.repo | 2023-03-17 13:07 | 443 | |
| virt-copr9-ol9.repo | 2023-03-10 18:44 | 233 | |
| info-docker-images | 2022-11-25 12:17 | 1.3K | |
| copr-git-al91-nov22.png | 2022-11-22 12:10 | 560K | |
| copr-3b24430f4f32.tar.zst | 2022-07-21 10:45 | 6.7M | |
| my-copr-puma9.tar.xz | 2022-07-18 15:56 | 6.7K | |
| copr-stats-jul22.png | 2022-07-18 13:46 | 83K | |
| comps.x86_64.xml | 2022-06-22 11:00 | 139K | |
About Puma9 --- This is an EL9 collection of packages needed to build & run the Copr Fedora Project using EL9 packages only. Call it an EL9 port of Copr. The canonical Copr packages for epel-9, found here, https://download.copr.fedorainfracloud.org/results/@copr/copr/epel-9-x86_64 are incomplete and may contain unsupported features, plus there are hundreds of BuildRequires needed for the build. Instead, we will use this Copr repo (by prymar56) with a proven set of supporting packages: https://download.copr.fedorainfracloud.org/results/prymar56/stream9-extra/epel-9-x86_64, prymar56/stream9-extra The git repo for Copr is here (as of Dec 01, 2022): git clone https://github.com/fedora-copr/copr.git Our build is branched here: 3d6f625942c38286b65f-frontend: pagure-events: don't submit builds for disabled projects-Mon Jun 27 15:24 Next, we will rebuild the AL-9 minimal docker image, adding 2 new repos, then call it Puma9. This is the new base image for our EL9 Copr. Patches and file structure for the puma9 setup, here: my-copr-puma9.tar.xz More info about dockerized Copr is at the frostyx blog Once Copr is dockerized you will see these docker images. After docker-compose runs, these are the containers. Author --- PryMar56 Apr 2023